About 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one
8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one (PubChem CID 22004765) has the molecular formula C17H14O2S
and a molecular weight of 282.36 g/mol. Its IUPAC name is 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one.
Molecular Properties
| Compound Name | 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one |
| PubChem CID | 22004765 |
| Molecular Formula | C17H14O2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one |
| SMILES | COc1ccc2c(c1)sc1c3c(ccc12)C(=O)CC3C |
| InChI | InChI=1S/C17H14O2S/c1-9-7-14(18)13-6-5-12-11-4-3-10(19-2)8-15(11)20-17(12)16(9)13/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | DMOXJMJQWDUQSQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one?
The IUPAC name of 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one (CID 22004765) is 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one.
What is the SMILES notation for 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one?
The canonical SMILES for 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one is COc1ccc2c(c1)sc1c3c(ccc12)C(=O)CC3C.
What is the InChIKey of 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one?
The InChIKey is DMOXJMJQWDUQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O2S/c1-9-7-14(18)13-6-5-12-11-4-3-10(19-2)8-15(11)20-17(12)16(9)13/h3-6,8-9H,7H2,1-2H3.
What are the key properties of 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one?
8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one has a molecular weight of 282.36 g/mol, XLogP of 4.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-1-methyl-1,2-dihydroindeno[4,5-b][1]benzothiol-3-one is sourced from PubChem (CID 22004765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).