About [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol
[5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol (PubChem CID 22005111) has the molecular formula C20H27NO
and a molecular weight of 297.44 g/mol. Its IUPAC name is [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
| PubChem CID | 22005111 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
| SMILES | CCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccccc1 |
| InChI | InChI=1S/C20H27NO/c1-6-16-18(15-10-8-7-9-11-15)17(12-22)20(14(4)5)21-19(16)13(2)3/h7-11,13-14,22H,6,12H2,1-5H3 |
| InChIKey | YXZAOVVNIMGSEO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol?
The IUPAC name of [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol (CID 22005111) is [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol.
What is the SMILES notation for [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol?
The canonical SMILES for [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol is CCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccccc1.
What is the InChIKey of [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol?
The InChIKey is YXZAOVVNIMGSEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO/c1-6-16-18(15-10-8-7-9-11-15)17(12-22)20(14(4)5)21-19(16)13(2)3/h7-11,13-14,22H,6,12H2,1-5H3.
What are the key properties of [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol?
[5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol has a molecular weight of 297.44 g/mol, XLogP of 5.05, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-ethyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol is sourced from PubChem (CID 22005111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).