About [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol
[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol (PubChem CID 22005204) has the molecular formula C21H28FNO
and a molecular weight of 329.46 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol |
| PubChem CID | 22005204 |
| Molecular Formula | C21H28FNO |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol |
| SMILES | CCCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H28FNO/c1-6-7-17-19(15-8-10-16(22)11-9-15)18(12-24)21(14(4)5)23-20(17)13(2)3/h8-11,13-14,24H,6-7,12H2,1-5H3 |
| InChIKey | CGERYLIZDURBOY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol?
The IUPAC name of [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol (CID 22005204) is [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol.
What is the SMILES notation for [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol?
The canonical SMILES for [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol is CCCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccc(F)cc1.
What is the InChIKey of [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol?
The InChIKey is CGERYLIZDURBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28FNO/c1-6-7-17-19(15-8-10-16(22)11-9-15)18(12-24)21(14(4)5)23-20(17)13(2)3/h8-11,13-14,24H,6-7,12H2,1-5H3.
What are the key properties of [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol?
[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol has a molecular weight of 329.46 g/mol, XLogP of 5.58, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]methanol is sourced from PubChem (CID 22005204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).