About [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol
[5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol (PubChem CID 22005277) has the molecular formula C21H29NOS
and a molecular weight of 343.54 g/mol. Its IUPAC name is [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol |
| PubChem CID | 22005277 |
| Molecular Formula | C21H29NOS |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol |
| SMILES | CCC/C=C/c1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccsc1 |
| InChI | InChI=1S/C21H29NOS/c1-6-7-8-9-17-19(16-10-11-24-13-16)18(12-23)21(15(4)5)22-20(17)14(2)3/h8-11,13-15,23H,6-7,12H2,1-5H3/b9-8+ |
| InChIKey | RDGJVPCJAMAIAC-CMDGGOBGSA-N |
| XLogP | 6.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol?
The IUPAC name of [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol (CID 22005277) is [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol.
What is the SMILES notation for [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol?
The canonical SMILES for [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol is CCC/C=C/c1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccsc1.
What is the InChIKey of [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol?
The InChIKey is RDGJVPCJAMAIAC-CMDGGOBGSA-N. The full InChI is InChI=1S/C21H29NOS/c1-6-7-8-9-17-19(16-10-11-24-13-16)18(12-23)21(15(4)5)22-20(17)14(2)3/h8-11,13-15,23H,6-7,12H2,1-5H3/b9-8+.
What are the key properties of [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol?
[5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol has a molecular weight of 343.54 g/mol, XLogP of 6.36, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(E)-pent-1-enyl]-2,6-di(propan-2-yl)-4-thiophen-3-yl-3-pyridinyl]methanol is sourced from PubChem (CID 22005277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).