About [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol
[5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol (PubChem CID 22005335) has the molecular formula C23H33NO
and a molecular weight of 339.52 g/mol. Its IUPAC name is [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
| PubChem CID | 22005335 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
| SMILES | CCCCCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccccc1 |
| InChI | InChI=1S/C23H33NO/c1-6-7-9-14-19-21(18-12-10-8-11-13-18)20(15-25)23(17(4)5)24-22(19)16(2)3/h8,10-13,16-17,25H,6-7,9,14-15H2,1-5H3 |
| InChIKey | JJSFGIZTXNWLSJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol?
The IUPAC name of [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol (CID 22005335) is [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol.
What is the SMILES notation for [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol?
The canonical SMILES for [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol is CCCCCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccccc1.
What is the InChIKey of [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol?
The InChIKey is JJSFGIZTXNWLSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33NO/c1-6-7-9-14-19-21(18-12-10-8-11-13-18)20(15-25)23(17(4)5)24-22(19)16(2)3/h8,10-13,16-17,25H,6-7,9,14-15H2,1-5H3.
What are the key properties of [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol?
[5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol has a molecular weight of 339.52 g/mol, XLogP of 6.22, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-pentyl-4-phenyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol is sourced from PubChem (CID 22005335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).