C20H24FNO5 — CID 22005368
diethyl 4-(4-fluorophenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 22005368) has the molecular formula C20H24FNO5 and a molecular weight of 377.41 g/mol. Its IUPAC name is diethyl 4-(4-fluorophenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(4-fluorophenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 22005368 |
| Molecular Formula | C20H24FNO5 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | diethyl 4-(4-fluorophenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(C)C)NC(=O)C(C(=O)OCC)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FNO5/c1-5-26-19(24)15-14(12-7-9-13(21)10-8-12)16(20(25)27-6-2)18(23)22-17(15)11(3)4/h7-11,14,16H,5-6H2,1-4H3,(H,22,23) |
| InChIKey | CDNIXAZIFADCIK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|