About 2,3,3-trifluoropropylurea
2,3,3-trifluoropropylurea (PubChem CID 22005458) has the molecular formula C4H7F3N2O
and a molecular weight of 156.11 g/mol. Its IUPAC name is 2,3,3-trifluoropropylurea.
Molecular Properties
| Compound Name | 2,3,3-trifluoropropylurea |
| PubChem CID | 22005458 |
| Molecular Formula | C4H7F3N2O |
| Molecular Weight | 156.11 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2,3,3-trifluoropropylurea |
| SMILES | NC(=O)NCC(F)C(F)F |
| InChI | InChI=1S/C4H7F3N2O/c5-2(3(6)7)1-9-4(8)10/h2-3H,1H2,(H3,8,9,10) |
| InChIKey | DFYNZIDULIQTGP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.11 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,3-trifluoropropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3-trifluoropropylurea?
The IUPAC name of 2,3,3-trifluoropropylurea (CID 22005458) is 2,3,3-trifluoropropylurea.
What is the SMILES notation for 2,3,3-trifluoropropylurea?
The canonical SMILES for 2,3,3-trifluoropropylurea is NC(=O)NCC(F)C(F)F.
What is the InChIKey of 2,3,3-trifluoropropylurea?
The InChIKey is DFYNZIDULIQTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7F3N2O/c5-2(3(6)7)1-9-4(8)10/h2-3H,1H2,(H3,8,9,10).
What are the key properties of 2,3,3-trifluoropropylurea?
2,3,3-trifluoropropylurea has a molecular weight of 156.11 g/mol, XLogP of 0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3-trifluoropropylurea is sourced from PubChem (CID 22005458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).