About 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate
7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate (PubChem CID 22006008) has the molecular formula C8H8O5-2
and a molecular weight of 184.15 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate.
Molecular Properties
| Compound Name | 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
| PubChem CID | 22006008 |
| Molecular Formula | C8H8O5-2 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
| SMILES | O=C([O-])C1CC2OC2CC1C(=O)[O-] |
| InChI | InChI=1S/C8H10O5/c9-7(10)3-1-5-6(13-5)2-4(3)8(11)12/h3-6H,1-2H2,(H,9,10)(H,11,12)/p-2 |
| InChIKey | SDUZNEIVCAVWSH-UHFFFAOYSA-L |
| XLogP | -2.72 |
| TPSA | 92.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate?
The IUPAC name of 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate (CID 22006008) is 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate.
What is the SMILES notation for 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate?
The canonical SMILES for 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate is O=C([O-])C1CC2OC2CC1C(=O)[O-].
What is the InChIKey of 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate?
The InChIKey is SDUZNEIVCAVWSH-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H10O5/c9-7(10)3-1-5-6(13-5)2-4(3)8(11)12/h3-6H,1-2H2,(H,9,10)(H,11,12)/p-2.
What are the key properties of 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate?
7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate has a molecular weight of 184.15 g/mol, XLogP of -2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate is sourced from PubChem (CID 22006008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).