C20H10F5N3O — CID 2200641
N-[4-(1H-benzimidazol-2-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 2200641) has the molecular formula C20H10F5N3O and a molecular weight of 403.31 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 2200641 |
| Molecular Formula | C20H10F5N3O |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3[nH]2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H10F5N3O/c21-14-13(15(22)17(24)18(25)16(14)23)20(29)26-10-7-5-9(6-8-10)19-27-11-3-1-2-4-12(11)28-19/h1-8H,(H,26,29)(H,27,28) |
| InChIKey | ABRMNMWSRYGJAX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|