C19H24N6O4 — CID 22006514
3-[[5-[4-(1H-imidazol-2-ylamino)butyl]-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 22006514) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is 3-[[5-[4-(1H-imidazol-2-ylamino)butyl]-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[5-[4-(1H-imidazol-2-ylamino)butyl]-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 22006514 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 3-[[5-[4-(1H-imidazol-2-ylamino)butyl]-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)C1=NOC(CCCCNc2ncc[nH]2)C1)c1cccnc1 |
| InChI | InChI=1S/C19H24N6O4/c26-17(27)11-15(13-4-3-6-20-12-13)24-18(28)16-10-14(29-25-16)5-1-2-7-21-19-22-8-9-23-19/h3-4,6,8-9,12,14-15H,1-2,5,7,10-11H2,(H,24,28)(H,26,27)(H2,21,22,23) |
| InChIKey | KFMCGEXTUUJHBK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|