C27H30N6O5S — CID 22006664
2-[(2,6-dimethylphenyl)sulfonylamino]-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-4-carbonyl]amino]propanoic acid (PubChem CID 22006664) has the molecular formula C27H30N6O5S and a molecular weight of 550.64 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenyl)sulfonylamino]-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-4-carbonyl]amino]propanoic acid.
| Compound Name | 2-[(2,6-dimethylphenyl)sulfonylamino]-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22006664 |
| Molecular Formula | C27H30N6O5S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 2-[(2,6-dimethylphenyl)sulfonylamino]-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-4-carbonyl]amino]propanoic acid |
| SMILES | Cc1cccc(C)c1S(=O)(=O)NC(CNC(=O)c1cccc2c1cnn2CCCNc1ccccn1)C(=O)O |
| InChI | InChI=1S/C27H30N6O5S/c1-18-8-5-9-19(2)25(18)39(37,38)32-22(27(35)36)17-30-26(34)20-10-6-11-23-21(20)16-31-33(23)15-7-14-29-24-12-3-4-13-28-24/h3-6,8-13,16,22,32H,7,14-15,17H2,1-2H3,(H,28,29)(H,30,34)(H,35,36) |
| InChIKey | HHJBDBGWKGZLLE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 155.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|