About disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate
disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate (PubChem CID 22007903) has the molecular formula C10H7NNa2O8S2
and a molecular weight of 379.28 g/mol. Its IUPAC name is disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate.
Molecular Properties
| Compound Name | disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate |
| PubChem CID | 22007903 |
| Molecular Formula | C10H7NNa2O8S2 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate |
| SMILES | Nc1cc(OS(=O)(=O)[O-])c2cccc(OS(=O)(=O)[O-])c2c1.[Na+].[Na+] |
| InChI | InChI=1S/C10H9NO8S2.2Na/c11-6-4-8-7(10(5-6)19-21(15,16)17)2-1-3-9(8)18-20(12,13)14;;/h1-5H,11H2,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2 |
| InChIKey | QZQQKLLFMKSMNW-UHFFFAOYSA-L |
| XLogP | -5.89 |
| TPSA | 158.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate?
The IUPAC name of disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate (CID 22007903) is disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate.
What is the SMILES notation for disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate?
The canonical SMILES for disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate is Nc1cc(OS(=O)(=O)[O-])c2cccc(OS(=O)(=O)[O-])c2c1.[Na+].[Na+].
What is the InChIKey of disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate?
The InChIKey is QZQQKLLFMKSMNW-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H9NO8S2.2Na/c11-6-4-8-7(10(5-6)19-21(15,16)17)2-1-3-9(8)18-20(12,13)14;;/h1-5H,11H2,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2.
What are the key properties of disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate?
disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate has a molecular weight of 379.28 g/mol, XLogP of -5.89, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(3-amino-5-sulfonatooxynaphthalen-1-yl) sulfate is sourced from PubChem (CID 22007903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).