C14H14N4O8 — CID 22008153
3,4,5,6-tetrahydroxy-1,8-bis(1H-imidazol-2-yl)octane-1,2,7,8-tetrone (PubChem CID 22008153) has the molecular formula C14H14N4O8 and a molecular weight of 366.29 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxy-1,8-bis(1H-imidazol-2-yl)octane-1,2,7,8-tetrone.
| Compound Name | 3,4,5,6-tetrahydroxy-1,8-bis(1H-imidazol-2-yl)octane-1,2,7,8-tetrone |
|---|---|
| PubChem CID | 22008153 |
| Molecular Formula | C14H14N4O8 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3,4,5,6-tetrahydroxy-1,8-bis(1H-imidazol-2-yl)octane-1,2,7,8-tetrone |
| SMILES | O=C(C(=O)C(O)C(O)C(O)C(O)C(=O)C(=O)c1ncc[nH]1)c1ncc[nH]1 |
| InChI | InChI=1S/C14H14N4O8/c19-5(7(21)9(23)11(25)13-15-1-2-16-13)6(20)8(22)10(24)12(26)14-17-3-4-18-14/h1-8,19-22H,(H,15,16)(H,17,18) |
| InChIKey | XSBILHCMQNGMKC-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 206.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|