C19H8F5NO2 — CID 2200914
N-dibenzofuran-3-yl-2,3,4,5,6-pentafluorobenzamide (PubChem CID 2200914) has the molecular formula C19H8F5NO2 and a molecular weight of 377.27 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-dibenzofuran-3-yl-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 2200914 |
| Molecular Formula | C19H8F5NO2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-dibenzofuran-3-yl-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)oc1ccccc12)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H8F5NO2/c20-14-13(15(21)17(23)18(24)16(14)22)19(26)25-8-5-6-10-9-3-1-2-4-11(9)27-12(10)7-8/h1-7H,(H,25,26) |
| InChIKey | DGTIXLRCYSILBW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|