About 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole
2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole (PubChem CID 22009756) has the molecular formula C24H24N4O2
and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole |
| PubChem CID | 22009756 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole |
| SMILES | C(=C/c1nc(COc2ccc(CCCCn3nccn3)cc2)co1)\c1ccccc1 |
| InChI | InChI=1S/C24H24N4O2/c1-2-6-20(7-3-1)11-14-24-27-22(19-30-24)18-29-23-12-9-21(10-13-23)8-4-5-17-28-25-15-16-26-28/h1-3,6-7,9-16,19H,4-5,8,17-18H2/b14-11+ |
| InChIKey | NHLAISBHMBWXBK-SDNWHVSQSA-N |
| XLogP | 5.04 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole?
The IUPAC name of 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole (CID 22009756) is 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole.
What is the SMILES notation for 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole?
The canonical SMILES for 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole is C(=C/c1nc(COc2ccc(CCCCn3nccn3)cc2)co1)\c1ccccc1.
What is the InChIKey of 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole?
The InChIKey is NHLAISBHMBWXBK-SDNWHVSQSA-N. The full InChI is InChI=1S/C24H24N4O2/c1-2-6-20(7-3-1)11-14-24-27-22(19-30-24)18-29-23-12-9-21(10-13-23)8-4-5-17-28-25-15-16-26-28/h1-3,6-7,9-16,19H,4-5,8,17-18H2/b14-11+.
What are the key properties of 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole?
2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole has a molecular weight of 400.48 g/mol, XLogP of 5.04, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-phenylethenyl]-4-[[4-[4-(triazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole is sourced from PubChem (CID 22009756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).