C9H11F9 — CID 22011096
1,1,1,2,2,3,3,4,4-nonafluoro-7-methyloctane (PubChem CID 22011096) has the molecular formula C9H11F9 and a molecular weight of 290.17 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-7-methyloctane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-7-methyloctane |
|---|---|
| PubChem CID | 22011096 |
| Molecular Formula | C9H11F9 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-7-methyloctane |
| SMILES | CC(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F9/c1-5(2)3-4-6(10,11)7(12,13)8(14,15)9(16,17)18/h5H,3-4H2,1-2H3 |
| InChIKey | RMMGYQOEACDUHV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|