C9H18N18 — CID 22011128
1,3,5-triazine-2,4,6-triamine (PubChem CID 22011128) has the molecular formula C9H18N18 and a molecular weight of 378.37 g/mol. Its IUPAC name is 1,3,5-triazine-2,4,6-triamine.
| Compound Name | 1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 22011128 |
| Molecular Formula | C9H18N18 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(N)n1.Nc1nc(N)nc(N)n1.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/3C3H6N6/c3*4-1-7-2(5)9-3(6)8-1/h3*(H6,4,5,6,7,8,9) |
| InChIKey | XHZOOYUNUYDKCO-UHFFFAOYSA-N |
| XLogP | -4.15 |
| TPSA | 350.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |