About 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane
4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane (PubChem CID 22011168) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane.
Molecular Properties
| Compound Name | 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane |
| PubChem CID | 22011168 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane |
| SMILES | C=CCOCC1(CC)CCOC(C)(C)O1 |
| InChI | InChI=1S/C12H22O3/c1-5-8-13-10-12(6-2)7-9-14-11(3,4)15-12/h5H,1,6-10H2,2-4H3 |
| InChIKey | ALMXOSACQNGFDE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane?
The IUPAC name of 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane (CID 22011168) is 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane.
What is the SMILES notation for 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane?
The canonical SMILES for 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane is C=CCOCC1(CC)CCOC(C)(C)O1.
What is the InChIKey of 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane?
The InChIKey is ALMXOSACQNGFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-5-8-13-10-12(6-2)7-9-14-11(3,4)15-12/h5H,1,6-10H2,2-4H3.
What are the key properties of 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane?
4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane has a molecular weight of 214.30 g/mol, XLogP of 2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,2-dimethyl-4-(prop-2-enoxymethyl)-1,3-dioxane is sourced from PubChem (CID 22011168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).