About S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate
S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate (PubChem CID 22011529) has the molecular formula C18H10Cl4O2S3
and a molecular weight of 496.29 g/mol. Its IUPAC name is S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate.
Molecular Properties
| Compound Name | S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate |
| PubChem CID | 22011529 |
| Molecular Formula | C18H10Cl4O2S3 |
| Molecular Weight | 496.29 g/mol |
| Exact Mass | 493.86 |
| IUPAC Name | S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate |
| SMILES | C=CC(=O)Sc1c(Cl)cc(Sc2cc(Cl)c(SC(=O)C=C)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C18H10Cl4O2S3/c1-3-15(23)26-17-11(19)5-9(6-12(17)20)25-10-7-13(21)18(14(22)8-10)27-16(24)4-2/h3-8H,1-2H2 |
| InChIKey | KVCAJBUFRSVXBB-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.29 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate?
The IUPAC name of S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate (CID 22011529) is S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate.
What is the SMILES notation for S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate?
The canonical SMILES for S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate is C=CC(=O)Sc1c(Cl)cc(Sc2cc(Cl)c(SC(=O)C=C)c(Cl)c2)cc1Cl.
What is the InChIKey of S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate?
The InChIKey is KVCAJBUFRSVXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Cl4O2S3/c1-3-15(23)26-17-11(19)5-9(6-12(17)20)25-10-7-13(21)18(14(22)8-10)27-16(24)4-2/h3-8H,1-2H2.
What are the key properties of S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate?
S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate has a molecular weight of 496.29 g/mol, XLogP of 8.06, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2,6-dichloro-4-(3,5-dichloro-4-prop-2-enoylsulfanylphenyl)sulfanylphenyl] prop-2-enethioate is sourced from PubChem (CID 22011529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).