C4H5F6NO2P2 — CID 22011670
2,2,2-trifluoroethoxy-(2,2,2-trifluoroethoxyphosphanylideneamino)phosphane (PubChem CID 22011670) has the molecular formula C4H5F6NO2P2 and a molecular weight of 275.02 g/mol. Its IUPAC name is 2,2,2-trifluoroethoxy-(2,2,2-trifluoroethoxyphosphanylideneamino)phosphane.
| Compound Name | 2,2,2-trifluoroethoxy-(2,2,2-trifluoroethoxyphosphanylideneamino)phosphane |
|---|---|
| PubChem CID | 22011670 |
| Molecular Formula | C4H5F6NO2P2 |
| Molecular Weight | 275.02 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | 2,2,2-trifluoroethoxy-(2,2,2-trifluoroethoxyphosphanylideneamino)phosphane |
| SMILES | FC(F)(F)CO/P=N/POCC(F)(F)F |
| InChI | InChI=1S/C4H5F6NO2P2/c5-3(6,7)1-12-14-11-15-13-2-4(8,9)10/h14H,1-2H2 |
| InChIKey | FDNAVZZUSQGKPI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.02 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|