About 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride
1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride (PubChem CID 22011674) has the molecular formula C7H13ClN2
and a molecular weight of 160.65 g/mol. Its IUPAC name is 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride.
Molecular Properties
| Compound Name | 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride |
| PubChem CID | 22011674 |
| Molecular Formula | C7H13ClN2 |
| Molecular Weight | 160.65 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride |
| SMILES | C=CN1CC[N+](C)=C1C.[Cl-] |
| InChI | InChI=1S/C7H13N2.ClH/c1-4-9-6-5-8(3)7(9)2;/h4H,1,5-6H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | QZHDVBKGSOAMHR-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.65 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride?
The IUPAC name of 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride (CID 22011674) is 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride.
What is the SMILES notation for 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride?
The canonical SMILES for 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride is C=CN1CC[N+](C)=C1C.[Cl-].
What is the InChIKey of 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride?
The InChIKey is QZHDVBKGSOAMHR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13N2.ClH/c1-4-9-6-5-8(3)7(9)2;/h4H,1,5-6H2,2-3H3;1H/q+1;/p-1.
What are the key properties of 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride?
1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride has a molecular weight of 160.65 g/mol, XLogP of -2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium chloride is sourced from PubChem (CID 22011674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).