C29H29N5O4S — CID 22011960
6-[5-[(3-methylsulfonylpropylamino)methyl]furan-2-yl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 22011960) has the molecular formula C29H29N5O4S and a molecular weight of 543.65 g/mol. Its IUPAC name is 6-[5-[(3-methylsulfonylpropylamino)methyl]furan-2-yl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-[5-[(3-methylsulfonylpropylamino)methyl]furan-2-yl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22011960 |
| Molecular Formula | C29H29N5O4S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 6-[5-[(3-methylsulfonylpropylamino)methyl]furan-2-yl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)CCCNCc1ccc(-c2cc3c(Nc4ccc(OCc5ccccc5)cc4)ncnc3cn2)o1 |
| InChI | InChI=1S/C29H29N5O4S/c1-39(35,36)15-5-14-30-17-24-12-13-28(38-24)26-16-25-27(18-31-26)32-20-33-29(25)34-22-8-10-23(11-9-22)37-19-21-6-3-2-4-7-21/h2-4,6-13,16,18,20,30H,5,14-15,17,19H2,1H3,(H,32,33,34) |
| InChIKey | NVWYKCCRMGMTKD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|