C15H14FN3O — CID 22012031
3-(2-fluoro-3-pyridinyl)-8-hydroxy-2-methyl-5,6,7,8-tetrahydroindolizine-1-carbonitrile (PubChem CID 22012031) has the molecular formula C15H14FN3O and a molecular weight of 271.29 g/mol. Its IUPAC name is 3-(2-fluoro-3-pyridinyl)-8-hydroxy-2-methyl-5,6,7,8-tetrahydroindolizine-1-carbonitrile.
| Compound Name | 3-(2-fluoro-3-pyridinyl)-8-hydroxy-2-methyl-5,6,7,8-tetrahydroindolizine-1-carbonitrile |
|---|---|
| PubChem CID | 22012031 |
| Molecular Formula | C15H14FN3O |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-(2-fluoro-3-pyridinyl)-8-hydroxy-2-methyl-5,6,7,8-tetrahydroindolizine-1-carbonitrile |
| SMILES | Cc1c(C#N)c2n(c1-c1cccnc1F)CCCC2O |
| InChI | InChI=1S/C15H14FN3O/c1-9-11(8-17)14-12(20)5-3-7-19(14)13(9)10-4-2-6-18-15(10)16/h2,4,6,12,20H,3,5,7H2,1H3 |
| InChIKey | UXAXHSFGUNNGRA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|