C15H11FN4O — CID 22012045
3-(2-fluoro-3-pyridinyl)-8-hydroxy-5,6,7,8-tetrahydroindolizine-1,2-dicarbonitrile (PubChem CID 22012045) has the molecular formula C15H11FN4O and a molecular weight of 282.28 g/mol. Its IUPAC name is 3-(2-fluoro-3-pyridinyl)-8-hydroxy-5,6,7,8-tetrahydroindolizine-1,2-dicarbonitrile.
| Compound Name | 3-(2-fluoro-3-pyridinyl)-8-hydroxy-5,6,7,8-tetrahydroindolizine-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 22012045 |
| Molecular Formula | C15H11FN4O |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-(2-fluoro-3-pyridinyl)-8-hydroxy-5,6,7,8-tetrahydroindolizine-1,2-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c2n(c1-c1cccnc1F)CCCC2O |
| InChI | InChI=1S/C15H11FN4O/c16-15-9(3-1-5-19-15)13-10(7-17)11(8-18)14-12(21)4-2-6-20(13)14/h1,3,5,12,21H,2,4,6H2 |
| InChIKey | DLFNFESSLJYHHA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|