C15H13ClFN3O — CID 22012049
2-chloro-3-(2-fluoro-3-pyridinyl)-8-methoxy-5,6,7,8-tetrahydroindolizine-1-carbonitrile (PubChem CID 22012049) has the molecular formula C15H13ClFN3O and a molecular weight of 305.74 g/mol. Its IUPAC name is 2-chloro-3-(2-fluoro-3-pyridinyl)-8-methoxy-5,6,7,8-tetrahydroindolizine-1-carbonitrile.
| Compound Name | 2-chloro-3-(2-fluoro-3-pyridinyl)-8-methoxy-5,6,7,8-tetrahydroindolizine-1-carbonitrile |
|---|---|
| PubChem CID | 22012049 |
| Molecular Formula | C15H13ClFN3O |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-chloro-3-(2-fluoro-3-pyridinyl)-8-methoxy-5,6,7,8-tetrahydroindolizine-1-carbonitrile |
| SMILES | COC1CCCn2c(-c3cccnc3F)c(Cl)c(C#N)c21 |
| InChI | InChI=1S/C15H13ClFN3O/c1-21-11-5-3-7-20-13(11)10(8-18)12(16)14(20)9-4-2-6-19-15(9)17/h2,4,6,11H,3,5,7H2,1H3 |
| InChIKey | XFSJDTUOIAXARN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|