C14H11ClFN3O — CID 22012062
2-chloro-3-(2-fluoro-3-pyridinyl)-8-hydroxy-5,6,7,8-tetrahydroindolizine-1-carbonitrile (PubChem CID 22012062) has the molecular formula C14H11ClFN3O and a molecular weight of 291.71 g/mol. Its IUPAC name is 2-chloro-3-(2-fluoro-3-pyridinyl)-8-hydroxy-5,6,7,8-tetrahydroindolizine-1-carbonitrile.
| Compound Name | 2-chloro-3-(2-fluoro-3-pyridinyl)-8-hydroxy-5,6,7,8-tetrahydroindolizine-1-carbonitrile |
|---|---|
| PubChem CID | 22012062 |
| Molecular Formula | C14H11ClFN3O |
| Molecular Weight | 291.71 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-chloro-3-(2-fluoro-3-pyridinyl)-8-hydroxy-5,6,7,8-tetrahydroindolizine-1-carbonitrile |
| SMILES | N#Cc1c(Cl)c(-c2cccnc2F)n2c1C(O)CCC2 |
| InChI | InChI=1S/C14H11ClFN3O/c15-11-9(7-17)12-10(20)4-2-6-19(12)13(11)8-3-1-5-18-14(8)16/h1,3,5,10,20H,2,4,6H2 |
| InChIKey | UOCZGQWGARLKFR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.71 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|