C16H17FN2O3 — CID 22012094
methyl 3-(2-fluoro-3-pyridinyl)-8-hydroxy-2-methyl-5,6,7,8-tetrahydroindolizine-1-carboxylate (PubChem CID 22012094) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is methyl 3-(2-fluoro-3-pyridinyl)-8-hydroxy-2-methyl-5,6,7,8-tetrahydroindolizine-1-carboxylate.
| Compound Name | methyl 3-(2-fluoro-3-pyridinyl)-8-hydroxy-2-methyl-5,6,7,8-tetrahydroindolizine-1-carboxylate |
|---|---|
| PubChem CID | 22012094 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl 3-(2-fluoro-3-pyridinyl)-8-hydroxy-2-methyl-5,6,7,8-tetrahydroindolizine-1-carboxylate |
| SMILES | COC(=O)c1c(C)c(-c2cccnc2F)n2c1C(O)CCC2 |
| InChI | InChI=1S/C16H17FN2O3/c1-9-12(16(21)22-2)14-11(20)6-4-8-19(14)13(9)10-5-3-7-18-15(10)17/h3,5,7,11,20H,4,6,8H2,1-2H3 |
| InChIKey | NRRFGYYCMFAQDL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|