C16H14ClF3N2O2 — CID 22012101
1-[3-(2-chloro-3-pyridinyl)-8-hydroxy-2-(trifluoromethyl)-5,6,7,8-tetrahydroindolizin-1-yl]ethanone (PubChem CID 22012101) has the molecular formula C16H14ClF3N2O2 and a molecular weight of 358.75 g/mol. Its IUPAC name is 1-[3-(2-chloro-3-pyridinyl)-8-hydroxy-2-(trifluoromethyl)-5,6,7,8-tetrahydroindolizin-1-yl]ethanone.
| Compound Name | 1-[3-(2-chloro-3-pyridinyl)-8-hydroxy-2-(trifluoromethyl)-5,6,7,8-tetrahydroindolizin-1-yl]ethanone |
|---|---|
| PubChem CID | 22012101 |
| Molecular Formula | C16H14ClF3N2O2 |
| Molecular Weight | 358.75 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-[3-(2-chloro-3-pyridinyl)-8-hydroxy-2-(trifluoromethyl)-5,6,7,8-tetrahydroindolizin-1-yl]ethanone |
| SMILES | CC(=O)c1c(C(F)(F)F)c(-c2cccnc2Cl)n2c1C(O)CCC2 |
| InChI | InChI=1S/C16H14ClF3N2O2/c1-8(23)11-12(16(18,19)20)13(9-4-2-6-21-15(9)17)22-7-3-5-10(24)14(11)22/h2,4,6,10,24H,3,5,7H2,1H3 |
| InChIKey | DCBFEEIIUJLDLH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.75 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|