About spiro[1H-naphthalene-4,4'-piperidine]
spiro[1H-naphthalene-4,4'-piperidine] (PubChem CID 22012177) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is spiro[1H-naphthalene-4,4'-piperidine].
Molecular Properties
| Compound Name | spiro[1H-naphthalene-4,4'-piperidine] |
| PubChem CID | 22012177 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | spiro[1H-naphthalene-4,4'-piperidine] |
| SMILES | C1=CC2(CCNCC2)c2ccccc2C1 |
| InChI | InChI=1S/C14H17N/c1-2-6-13-12(4-1)5-3-7-14(13)8-10-15-11-9-14/h1-4,6-7,15H,5,8-11H2 |
| InChIKey | ISQRAYINJCWWLE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze spiro[1H-naphthalene-4,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-naphthalene-4,4'-piperidine]?
The IUPAC name of spiro[1H-naphthalene-4,4'-piperidine] (CID 22012177) is spiro[1H-naphthalene-4,4'-piperidine].
What is the SMILES notation for spiro[1H-naphthalene-4,4'-piperidine]?
The canonical SMILES for spiro[1H-naphthalene-4,4'-piperidine] is C1=CC2(CCNCC2)c2ccccc2C1.
What is the InChIKey of spiro[1H-naphthalene-4,4'-piperidine]?
The InChIKey is ISQRAYINJCWWLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N/c1-2-6-13-12(4-1)5-3-7-14(13)8-10-15-11-9-14/h1-4,6-7,15H,5,8-11H2.
What are the key properties of spiro[1H-naphthalene-4,4'-piperidine]?
spiro[1H-naphthalene-4,4'-piperidine] has a molecular weight of 199.30 g/mol, XLogP of 2.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-naphthalene-4,4'-piperidine] is sourced from PubChem (CID 22012177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).