About (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol
(5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol (PubChem CID 22012245) has the molecular formula C9H9FO2
and a molecular weight of 168.17 g/mol. Its IUPAC name is (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol.
Molecular Properties
| Compound Name | (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol |
| PubChem CID | 22012245 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol |
| SMILES | OCC1COc2ccc(F)cc21 |
| InChI | InChI=1S/C9H9FO2/c10-7-1-2-9-8(3-7)6(4-11)5-12-9/h1-3,6,11H,4-5H2 |
| InChIKey | CIWZXJOBXQEOJK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol?
The IUPAC name of (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol (CID 22012245) is (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol.
What is the SMILES notation for (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol?
The canonical SMILES for (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol is OCC1COc2ccc(F)cc21.
What is the InChIKey of (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol?
The InChIKey is CIWZXJOBXQEOJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO2/c10-7-1-2-9-8(3-7)6(4-11)5-12-9/h1-3,6,11H,4-5H2.
What are the key properties of (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol?
(5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol has a molecular weight of 168.17 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methanol is sourced from PubChem (CID 22012245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).