C34H47N3O6 — CID 22012979
(5-methyl-2-propan-2-ylcyclohexyl) 2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate (PubChem CID 22012979) has the molecular formula C34H47N3O6 and a molecular weight of 593.77 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate |
|---|---|
| PubChem CID | 22012979 |
| Molecular Formula | C34H47N3O6 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.35 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate |
| SMILES | CCOC(CN1C(=O)C(CC(=O)OC2CC(C)CCC2C(C)C)(NC(=O)Nc2ccc(C)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C34H47N3O6/c1-7-41-31(42-8-2)21-37-28-12-10-9-11-27(28)34(32(37)39,36-33(40)35-25-16-13-23(5)14-17-25)20-30(38)43-29-19-24(6)15-18-26(29)22(3)4/h9-14,16-17,22,24,26,29,31H,7-8,15,18-21H2,1-6H3,(H2,35,36,40) |
| InChIKey | SFVHCTVIWHAPQF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|