About 1-(2,2-diethoxyethyl)indole
1-(2,2-diethoxyethyl)indole (PubChem CID 22013069) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)indole.
Molecular Properties
| Compound Name | 1-(2,2-diethoxyethyl)indole |
| PubChem CID | 22013069 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(2,2-diethoxyethyl)indole |
| SMILES | CCOC(Cn1ccc2ccccc21)OCC |
| InChI | InChI=1S/C14H19NO2/c1-3-16-14(17-4-2)11-15-10-9-12-7-5-6-8-13(12)15/h5-10,14H,3-4,11H2,1-2H3 |
| InChIKey | YUEGZKLHHPSXQY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-diethoxyethyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-diethoxyethyl)indole?
The IUPAC name of 1-(2,2-diethoxyethyl)indole (CID 22013069) is 1-(2,2-diethoxyethyl)indole.
What is the SMILES notation for 1-(2,2-diethoxyethyl)indole?
The canonical SMILES for 1-(2,2-diethoxyethyl)indole is CCOC(Cn1ccc2ccccc21)OCC.
What is the InChIKey of 1-(2,2-diethoxyethyl)indole?
The InChIKey is YUEGZKLHHPSXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-3-16-14(17-4-2)11-15-10-9-12-7-5-6-8-13(12)15/h5-10,14H,3-4,11H2,1-2H3.
What are the key properties of 1-(2,2-diethoxyethyl)indole?
1-(2,2-diethoxyethyl)indole has a molecular weight of 233.31 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-diethoxyethyl)indole is sourced from PubChem (CID 22013069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).