About (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane
(4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane (PubChem CID 22013140) has the molecular formula C23H21ClF2OSi
and a molecular weight of 414.96 g/mol. Its IUPAC name is (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane |
| PubChem CID | 22013140 |
| Molecular Formula | C23H21ClF2OSi |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane |
| SMILES | C[Si](C)(/C(F)=C(/F)Cc1cccc(Oc2ccccc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClF2OSi/c1-28(2,21-13-11-18(24)12-14-21)23(26)22(25)16-17-7-6-10-20(15-17)27-19-8-4-3-5-9-19/h3-15H,16H2,1-2H3/b23-22+ |
| InChIKey | AXYCSMFKCAHJJM-GHVJWSGMSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane?
The IUPAC name of (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane (CID 22013140) is (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane.
What is the SMILES notation for (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane?
The canonical SMILES for (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane is C[Si](C)(/C(F)=C(/F)Cc1cccc(Oc2ccccc2)c1)c1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane?
The InChIKey is AXYCSMFKCAHJJM-GHVJWSGMSA-N. The full InChI is InChI=1S/C23H21ClF2OSi/c1-28(2,21-13-11-18(24)12-14-21)23(26)22(25)16-17-7-6-10-20(15-17)27-19-8-4-3-5-9-19/h3-15H,16H2,1-2H3/b23-22+.
What are the key properties of (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane?
(4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane has a molecular weight of 414.96 g/mol, XLogP of 6.98, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[(E)-1,2-difluoro-3-(3-phenoxyphenyl)prop-1-enyl]-dimethylsilane is sourced from PubChem (CID 22013140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).