C7H8F9N — CID 22013473
4,4,5,5,6,6,7,7,7-nonafluoroheptan-1-amine (PubChem CID 22013473) has the molecular formula C7H8F9N and a molecular weight of 277.13 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,7-nonafluoroheptan-1-amine.
| Compound Name | 4,4,5,5,6,6,7,7,7-nonafluoroheptan-1-amine |
|---|---|
| PubChem CID | 22013473 |
| Molecular Formula | C7H8F9N |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 4,4,5,5,6,6,7,7,7-nonafluoroheptan-1-amine |
| SMILES | NCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F9N/c8-4(9,2-1-3-17)5(10,11)6(12,13)7(14,15)16/h1-3,17H2 |
| InChIKey | WEMSKMWILHOKHG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|