About 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid
2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid (PubChem CID 2201386) has the molecular formula C21H14Cl2N2O5
and a molecular weight of 445.26 g/mol. Its IUPAC name is 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid |
| PubChem CID | 2201386 |
| Molecular Formula | C21H14Cl2N2O5 |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)/C(=C/c1ccc(Cl)cc1Cl)NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H14Cl2N2O5/c22-13-8-7-12(15(23)11-13)10-17(25-20(27)18-6-3-9-30-18)19(26)24-16-5-2-1-4-14(16)21(28)29/h1-11H,(H,24,26)(H,25,27)(H,28,29)/b17-10- |
| InChIKey | SWIIQHBXNMHNQB-YVLHZVERSA-N |
| XLogP | 4.69 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid?
The IUPAC name of 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid (CID 2201386) is 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid.
What is the SMILES notation for 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid?
The canonical SMILES for 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid is O=C(Nc1ccccc1C(=O)O)/C(=C/c1ccc(Cl)cc1Cl)NC(=O)c1ccco1.
What is the InChIKey of 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid?
The InChIKey is SWIIQHBXNMHNQB-YVLHZVERSA-N. The full InChI is InChI=1S/C21H14Cl2N2O5/c22-13-8-7-12(15(23)11-13)10-17(25-20(27)18-6-3-9-30-18)19(26)24-16-5-2-1-4-14(16)21(28)29/h1-11H,(H,24,26)(H,25,27)(H,28,29)/b17-10-.
What are the key properties of 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid?
2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid has a molecular weight of 445.26 g/mol, XLogP of 4.69, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(Z)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoic acid is sourced from PubChem (CID 2201386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).