About 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol
5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol (PubChem CID 22014270) has the molecular formula C10H17NOS
and a molecular weight of 199.32 g/mol. Its IUPAC name is 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol.
Molecular Properties
| Compound Name | 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol |
| PubChem CID | 22014270 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol |
| SMILES | Cc1nc(C)c(CCCCCO)s1 |
| InChI | InChI=1S/C10H17NOS/c1-8-10(13-9(2)11-8)6-4-3-5-7-12/h12H,3-7H2,1-2H3 |
| InChIKey | QQPGRNFIKGQAOS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol?
The IUPAC name of 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol (CID 22014270) is 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol.
What is the SMILES notation for 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol?
The canonical SMILES for 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol is Cc1nc(C)c(CCCCCO)s1.
What is the InChIKey of 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol?
The InChIKey is QQPGRNFIKGQAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NOS/c1-8-10(13-9(2)11-8)6-4-3-5-7-12/h12H,3-7H2,1-2H3.
What are the key properties of 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol?
5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol has a molecular weight of 199.32 g/mol, XLogP of 2.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dimethyl-1,3-thiazol-5-yl)pentan-1-ol is sourced from PubChem (CID 22014270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).