About 4-isothiocyanato-1,3-benzodioxole
4-isothiocyanato-1,3-benzodioxole (PubChem CID 22014381) has the molecular formula C8H5NO2S
and a molecular weight of 179.20 g/mol. Its IUPAC name is 4-isothiocyanato-1,3-benzodioxole.
Molecular Properties
| Compound Name | 4-isothiocyanato-1,3-benzodioxole |
| PubChem CID | 22014381 |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | 4-isothiocyanato-1,3-benzodioxole |
| SMILES | S=C=Nc1cccc2c1OCO2 |
| InChI | InChI=1S/C8H5NO2S/c12-4-9-6-2-1-3-7-8(6)11-5-10-7/h1-3H,5H2 |
| InChIKey | AEUPVGMPISNXFR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-isothiocyanato-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isothiocyanato-1,3-benzodioxole?
The IUPAC name of 4-isothiocyanato-1,3-benzodioxole (CID 22014381) is 4-isothiocyanato-1,3-benzodioxole.
What is the SMILES notation for 4-isothiocyanato-1,3-benzodioxole?
The canonical SMILES for 4-isothiocyanato-1,3-benzodioxole is S=C=Nc1cccc2c1OCO2.
What is the InChIKey of 4-isothiocyanato-1,3-benzodioxole?
The InChIKey is AEUPVGMPISNXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2S/c12-4-9-6-2-1-3-7-8(6)11-5-10-7/h1-3H,5H2.
What are the key properties of 4-isothiocyanato-1,3-benzodioxole?
4-isothiocyanato-1,3-benzodioxole has a molecular weight of 179.20 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isothiocyanato-1,3-benzodioxole is sourced from PubChem (CID 22014381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).