About 1-bromopropylcyclohexane
1-bromopropylcyclohexane (PubChem CID 22015028) has the molecular formula C9H17Br
and a molecular weight of 205.14 g/mol. Its IUPAC name is 1-bromopropylcyclohexane.
Molecular Properties
| Compound Name | 1-bromopropylcyclohexane |
| PubChem CID | 22015028 |
| Molecular Formula | C9H17Br |
| Molecular Weight | 205.14 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 1-bromopropylcyclohexane |
| SMILES | CCC(Br)C1CCCCC1 |
| InChI | InChI=1S/C9H17Br/c1-2-9(10)8-6-4-3-5-7-8/h8-9H,2-7H2,1H3 |
| InChIKey | OJGPQTDRLMZKFW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.14 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopropylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopropylcyclohexane?
The IUPAC name of 1-bromopropylcyclohexane (CID 22015028) is 1-bromopropylcyclohexane.
What is the SMILES notation for 1-bromopropylcyclohexane?
The canonical SMILES for 1-bromopropylcyclohexane is CCC(Br)C1CCCCC1.
What is the InChIKey of 1-bromopropylcyclohexane?
The InChIKey is OJGPQTDRLMZKFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17Br/c1-2-9(10)8-6-4-3-5-7-8/h8-9H,2-7H2,1H3.
What are the key properties of 1-bromopropylcyclohexane?
1-bromopropylcyclohexane has a molecular weight of 205.14 g/mol, XLogP of 3.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopropylcyclohexane is sourced from PubChem (CID 22015028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).