About 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole
1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole (PubChem CID 22015392) has the molecular formula C21H25N3O4S
and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole |
| PubChem CID | 22015392 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole |
| SMILES | COc1ccc(S(=O)(=O)n2ccc3cc(N4CCN(C)CC4)ccc32)cc1OC |
| InChI | InChI=1S/C21H25N3O4S/c1-22-10-12-23(13-11-22)17-4-6-19-16(14-17)8-9-24(19)29(25,26)18-5-7-20(27-2)21(15-18)28-3/h4-9,14-15H,10-13H2,1-3H3 |
| InChIKey | QCEWVKZGAFFFOJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole?
The IUPAC name of 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole (CID 22015392) is 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole.
What is the SMILES notation for 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole?
The canonical SMILES for 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole is COc1ccc(S(=O)(=O)n2ccc3cc(N4CCN(C)CC4)ccc32)cc1OC.
What is the InChIKey of 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole?
The InChIKey is QCEWVKZGAFFFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O4S/c1-22-10-12-23(13-11-22)17-4-6-19-16(14-17)8-9-24(19)29(25,26)18-5-7-20(27-2)21(15-18)28-3/h4-9,14-15H,10-13H2,1-3H3.
What are the key properties of 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole?
1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole has a molecular weight of 415.52 g/mol, XLogP of 2.65, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxyphenyl)sulfonyl-5-(4-methylpiperazin-1-yl)indole is sourced from PubChem (CID 22015392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).