About 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole
1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole (PubChem CID 22015409) has the molecular formula C20H23N3O2S
and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole |
| PubChem CID | 22015409 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole |
| SMILES | CC1CNCC(C)N1c1cccc2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O2S/c1-15-13-21-14-16(2)23(15)20-10-6-9-19-18(20)11-12-22(19)26(24,25)17-7-4-3-5-8-17/h3-12,15-16,21H,13-14H2,1-2H3 |
| InChIKey | BMYAQMFSTFLGEK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole?
The IUPAC name of 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole (CID 22015409) is 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole.
What is the SMILES notation for 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole?
The canonical SMILES for 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole is CC1CNCC(C)N1c1cccc2c1ccn2S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole?
The InChIKey is BMYAQMFSTFLGEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O2S/c1-15-13-21-14-16(2)23(15)20-10-6-9-19-18(20)11-12-22(19)26(24,25)17-7-4-3-5-8-17/h3-12,15-16,21H,13-14H2,1-2H3.
What are the key properties of 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole?
1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole has a molecular weight of 369.49 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-4-(2,6-dimethylpiperazin-1-yl)indole is sourced from PubChem (CID 22015409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).