About (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate
(1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate (PubChem CID 2201555) has the molecular formula C16H13NO7S
and a molecular weight of 363.35 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate.
Molecular Properties
| Compound Name | (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate |
| PubChem CID | 2201555 |
| Molecular Formula | C16H13NO7S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate |
| SMILES | COc1ccc(OC)c(S(=O)(=O)ON2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C16H13NO7S/c1-22-10-7-8-13(23-2)14(9-10)25(20,21)24-17-15(18)11-5-3-4-6-12(11)16(17)19/h3-9H,1-2H3 |
| InChIKey | USKUFPIZNUIYMV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate?
The IUPAC name of (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate (CID 2201555) is (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate is COc1ccc(OC)c(S(=O)(=O)ON2C(=O)c3ccccc3C2=O)c1.
What is the InChIKey of (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate?
The InChIKey is USKUFPIZNUIYMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO7S/c1-22-10-7-8-13(23-2)14(9-10)25(20,21)24-17-15(18)11-5-3-4-6-12(11)16(17)19/h3-9H,1-2H3.
What are the key properties of (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate?
(1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate has a molecular weight of 363.35 g/mol, XLogP of 1.62, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl) 2,5-dimethoxybenzenesulfonate is sourced from PubChem (CID 2201555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).