C17H16N2O2 — CID 22015632
8-methyl-2-[4-(oxiran-2-ylmethoxy)phenyl]imidazo[1,2-a]pyridine (PubChem CID 22015632) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 8-methyl-2-[4-(oxiran-2-ylmethoxy)phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 8-methyl-2-[4-(oxiran-2-ylmethoxy)phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 22015632 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 8-methyl-2-[4-(oxiran-2-ylmethoxy)phenyl]imidazo[1,2-a]pyridine |
| SMILES | Cc1cccn2cc(-c3ccc(OCC4CO4)cc3)nc12 |
| InChI | InChI=1S/C17H16N2O2/c1-12-3-2-8-19-9-16(18-17(12)19)13-4-6-14(7-5-13)20-10-15-11-21-15/h2-9,15H,10-11H2,1H3 |
| InChIKey | NULUVZHFUZAUHD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 39.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|