About 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one
4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one (PubChem CID 22015741) has the molecular formula C13H16N4O2S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one |
| PubChem CID | 22015741 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one |
| SMILES | COc1ccc(N2CCN(C)C(=O)C2)c2sc(N)nc12 |
| InChI | InChI=1S/C13H16N4O2S/c1-16-5-6-17(7-10(16)18)8-3-4-9(19-2)11-12(8)20-13(14)15-11/h3-4H,5-7H2,1-2H3,(H2,14,15) |
| InChIKey | IKZFBFSBWDDVEP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one?
The IUPAC name of 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one (CID 22015741) is 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one.
What is the SMILES notation for 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one?
The canonical SMILES for 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one is COc1ccc(N2CCN(C)C(=O)C2)c2sc(N)nc12.
What is the InChIKey of 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one?
The InChIKey is IKZFBFSBWDDVEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2S/c1-16-5-6-17(7-10(16)18)8-3-4-9(19-2)11-12(8)20-13(14)15-11/h3-4H,5-7H2,1-2H3,(H2,14,15).
What are the key properties of 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one?
4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one has a molecular weight of 292.36 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-4-methoxy-1,3-benzothiazol-7-yl)-1-methylpiperazin-2-one is sourced from PubChem (CID 22015741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).