C4H5F5O2S — CID 22015919
1-ethylsulfonyl-1,1,2,2,2-pentafluoroethane (PubChem CID 22015919) has the molecular formula C4H5F5O2S and a molecular weight of 212.14 g/mol. Its IUPAC name is 1-ethylsulfonyl-1,1,2,2,2-pentafluoroethane.
| Compound Name | 1-ethylsulfonyl-1,1,2,2,2-pentafluoroethane |
|---|---|
| PubChem CID | 22015919 |
| Molecular Formula | C4H5F5O2S |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 1-ethylsulfonyl-1,1,2,2,2-pentafluoroethane |
| SMILES | CCS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H5F5O2S/c1-2-12(10,11)4(8,9)3(5,6)7/h2H2,1H3 |
| InChIKey | XHRXNMCTHWMKSM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|