C16H16 — CID 22016155
3,7-dimethyltetracyclo[8.4.0.02,5.06,9]tetradeca-1(14),2(5),6(9),10,12-pentaene (PubChem CID 22016155) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 3,7-dimethyltetracyclo[8.4.0.02,5.06,9]tetradeca-1(14),2(5),6(9),10,12-pentaene.
| Compound Name | 3,7-dimethyltetracyclo[8.4.0.02,5.06,9]tetradeca-1(14),2(5),6(9),10,12-pentaene |
|---|---|
| PubChem CID | 22016155 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 3,7-dimethyltetracyclo[8.4.0.02,5.06,9]tetradeca-1(14),2(5),6(9),10,12-pentaene |
| SMILES | CC1Cc2c1c1c(c3ccccc23)C(C)C1 |
| InChI | InChI=1S/C16H16/c1-9-7-13-11-5-3-4-6-12(11)15-10(2)8-14(15)16(9)13/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | UDKHDSFRWWYOTB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |