About 2-iodopropane;hydrofluoride
2-iodopropane;hydrofluoride (PubChem CID 22016180) has the molecular formula C3H8FI
and a molecular weight of 190.00 g/mol. Its IUPAC name is 2-iodopropane;hydrofluoride.
Molecular Properties
| Compound Name | 2-iodopropane;hydrofluoride |
| PubChem CID | 22016180 |
| Molecular Formula | C3H8FI |
| Molecular Weight | 190.00 g/mol |
| Exact Mass | 189.97 |
| IUPAC Name | 2-iodopropane;hydrofluoride |
| SMILES | CC(C)I.F |
| InChI | InChI=1S/C3H7I.FH/c1-3(2)4;/h3H,1-2H3;1H |
| InChIKey | ZVBMAIZXVYMLNQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.00 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodopropane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodopropane;hydrofluoride?
The IUPAC name of 2-iodopropane;hydrofluoride (CID 22016180) is 2-iodopropane;hydrofluoride.
What is the SMILES notation for 2-iodopropane;hydrofluoride?
The canonical SMILES for 2-iodopropane;hydrofluoride is CC(C)I.F.
What is the InChIKey of 2-iodopropane;hydrofluoride?
The InChIKey is ZVBMAIZXVYMLNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7I.FH/c1-3(2)4;/h3H,1-2H3;1H.
What are the key properties of 2-iodopropane;hydrofluoride?
2-iodopropane;hydrofluoride has a molecular weight of 190.00 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodopropane;hydrofluoride is sourced from PubChem (CID 22016180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).