C12H24N4O2S — CID 22016322
N-[2-[(4,4-diamino-3-methylcyclohexa-2,5-dien-1-yl)-ethylamino]ethyl]methanesulfonamide (PubChem CID 22016322) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is N-[2-[(4,4-diamino-3-methylcyclohexa-2,5-dien-1-yl)-ethylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(4,4-diamino-3-methylcyclohexa-2,5-dien-1-yl)-ethylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 22016322 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[2-[(4,4-diamino-3-methylcyclohexa-2,5-dien-1-yl)-ethylamino]ethyl]methanesulfonamide |
| SMILES | CCN(CCNS(C)(=O)=O)C1C=CC(N)(N)C(C)=C1 |
| InChI | InChI=1S/C12H24N4O2S/c1-4-16(8-7-15-19(3,17)18)11-5-6-12(13,14)10(2)9-11/h5-6,9,11,15H,4,7-8,13-14H2,1-3H3 |
| InChIKey | AXRMGSZBYDJDKD-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|