About benzene-1,2-diol;ethane-1,2-diamine;hydrate
benzene-1,2-diol;ethane-1,2-diamine;hydrate (PubChem CID 22016463) has the molecular formula C8H16N2O3
and a molecular weight of 188.23 g/mol. Its IUPAC name is benzene-1,2-diol;ethane-1,2-diamine;hydrate.
Molecular Properties
| Compound Name | benzene-1,2-diol;ethane-1,2-diamine;hydrate |
| PubChem CID | 22016463 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | benzene-1,2-diol;ethane-1,2-diamine;hydrate |
| SMILES | NCCN.O.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.C2H8N2.H2O/c7-5-3-1-2-4-6(5)8;3-1-2-4;/h1-4,7-8H;1-4H2;1H2 |
| InChIKey | BQYUOKOEGIQOTC-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;ethane-1,2-diamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;ethane-1,2-diamine;hydrate?
The IUPAC name of benzene-1,2-diol;ethane-1,2-diamine;hydrate (CID 22016463) is benzene-1,2-diol;ethane-1,2-diamine;hydrate.
What is the SMILES notation for benzene-1,2-diol;ethane-1,2-diamine;hydrate?
The canonical SMILES for benzene-1,2-diol;ethane-1,2-diamine;hydrate is NCCN.O.Oc1ccccc1O.
What is the InChIKey of benzene-1,2-diol;ethane-1,2-diamine;hydrate?
The InChIKey is BQYUOKOEGIQOTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C2H8N2.H2O/c7-5-3-1-2-4-6(5)8;3-1-2-4;/h1-4,7-8H;1-4H2;1H2.
What are the key properties of benzene-1,2-diol;ethane-1,2-diamine;hydrate?
benzene-1,2-diol;ethane-1,2-diamine;hydrate has a molecular weight of 188.23 g/mol, XLogP of -0.82, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;ethane-1,2-diamine;hydrate is sourced from PubChem (CID 22016463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).