C9H9F9 — CID 22016472
1,1,3,4,4,5,6,6,6-nonafluoro-2,3,5-trimethylhex-1-ene (PubChem CID 22016472) has the molecular formula C9H9F9 and a molecular weight of 288.15 g/mol. Its IUPAC name is 1,1,3,4,4,5,6,6,6-nonafluoro-2,3,5-trimethylhex-1-ene.
| Compound Name | 1,1,3,4,4,5,6,6,6-nonafluoro-2,3,5-trimethylhex-1-ene |
|---|---|
| PubChem CID | 22016472 |
| Molecular Formula | C9H9F9 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1,1,3,4,4,5,6,6,6-nonafluoro-2,3,5-trimethylhex-1-ene |
| SMILES | CC(=C(F)F)C(C)(F)C(F)(F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F9/c1-4(5(10)11)6(2,12)8(14,15)7(3,13)9(16,17)18/h1-3H3 |
| InChIKey | SPVPFXNRDIDXNC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |