About 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine
2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine (PubChem CID 22016859) has the molecular formula C11H13NS2
and a molecular weight of 223.37 g/mol. Its IUPAC name is 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine.
Molecular Properties
| Compound Name | 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine |
| PubChem CID | 22016859 |
| Molecular Formula | C11H13NS2 |
| Molecular Weight | 223.37 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine |
| SMILES | Cc1ccccc1SC1=NCCCS1 |
| InChI | InChI=1S/C11H13NS2/c1-9-5-2-3-6-10(9)14-11-12-7-4-8-13-11/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | HEHYPNYRYWUEOZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine?
The IUPAC name of 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine (CID 22016859) is 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine.
What is the SMILES notation for 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine?
The canonical SMILES for 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine is Cc1ccccc1SC1=NCCCS1.
What is the InChIKey of 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine?
The InChIKey is HEHYPNYRYWUEOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS2/c1-9-5-2-3-6-10(9)14-11-12-7-4-8-13-11/h2-3,5-6H,4,7-8H2,1H3.
What are the key properties of 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine?
2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine has a molecular weight of 223.37 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylphenyl)sulfanyl-5,6-dihydro-4H-1,3-thiazine is sourced from PubChem (CID 22016859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).